C26H13F10N3 — CID 11489808
2,5-bis[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (PubChem CID 11489808) has the molecular formula C26H13F10N3 and a molecular weight of 557.39 g/mol. Its IUPAC name is 2,5-bis[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole.
| Compound Name | 2,5-bis[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 11489808 |
| Molecular Formula | C26H13F10N3 |
| Molecular Weight | 557.39 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 2,5-bis[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| SMILES | Fc1c(F)c(F)c(C(c2ccc[nH]2)c2ccc(C(c3ccc[nH]3)c3c(F)c(F)c(F)c(F)c3F)[nH]2)c(F)c1F |
| InChI | InChI=1S/C26H13F10N3/c27-17-15(18(28)22(32)25(35)21(17)31)13(9-3-1-7-37-9)11-5-6-12(39-11)14(10-4-2-8-38-10)16-19(29)23(33)26(36)24(34)20(16)30/h1-8,13-14,37-39H |
| InChIKey | LTEYAQPFWSZMLP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.39 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|