C9H16O6 — CID 114899523
4-(2-hydroxyethoxy)-2-methoxycarbonyl-2-methylbutanoic acid (PubChem CID 114899523) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-2-methoxycarbonyl-2-methylbutanoic acid.
| Compound Name | 4-(2-hydroxyethoxy)-2-methoxycarbonyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 114899523 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 4-(2-hydroxyethoxy)-2-methoxycarbonyl-2-methylbutanoic acid |
| SMILES | COC(=O)C(C)(CCOCCO)C(=O)O |
| InChI | InChI=1S/C9H16O6/c1-9(7(11)12,8(13)14-2)3-5-15-6-4-10/h10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | WLPVQNDXBJRLKA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|