C14H32O8 — CID 87452046
2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2-dimethylpropanoic acid;2-(2-hydroxyethoxy)ethanol (PubChem CID 87452046) has the molecular formula C14H32O8 and a molecular weight of 328.40 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2-dimethylpropanoic acid;2-(2-hydroxyethoxy)ethanol.
| Compound Name | 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2-dimethylpropanoic acid;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 87452046 |
| Molecular Formula | C14H32O8 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2,2-dimethylpropane-1,3-diol;3-hydroxy-2,2-dimethylpropanoic acid;2-(2-hydroxyethoxy)ethanol |
| SMILES | CC(C)(CO)C(=O)O.CC(C)(CO)CO.OCCOCCO |
| InChI | InChI=1S/C5H10O3.C5H12O2.C4H10O3/c1-5(2,3-6)4(7)8;1-5(2,3-6)4-7;5-1-3-7-4-2-6/h6H,3H2,1-2H3,(H,7,8);6-7H,3-4H2,1-2H3;5-6H,1-4H2 |
| InChIKey | IKNGPNSVDMOZFI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|