C11H20O10 — CID 87565303
2-(2-hydroxyethoxy)ethanol;2-methoxypropane-1,2,3-tricarboxylic acid (PubChem CID 87565303) has the molecular formula C11H20O10 and a molecular weight of 312.27 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;2-methoxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;2-methoxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87565303 |
| Molecular Formula | C11H20O10 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;2-methoxypropane-1,2,3-tricarboxylic acid |
| SMILES | COC(CC(=O)O)(CC(=O)O)C(=O)O.OCCOCCO |
| InChI | InChI=1S/C7H10O7.C4H10O3/c1-14-7(6(12)13,2-4(8)9)3-5(10)11;5-1-3-7-4-2-6/h2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13);5-6H,1-4H2 |
| InChIKey | SKEVHNSSKKXYID-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|