C15H20O14 — CID 58640862
2-[3-(1,2,3-tricarboxypropan-2-yloxy)propoxy]propane-1,2,3-tricarboxylic acid (PubChem CID 58640862) has the molecular formula C15H20O14 and a molecular weight of 424.31 g/mol. Its IUPAC name is 2-[3-(1,2,3-tricarboxypropan-2-yloxy)propoxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[3-(1,2,3-tricarboxypropan-2-yloxy)propoxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 58640862 |
| Molecular Formula | C15H20O14 |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-[3-(1,2,3-tricarboxypropan-2-yloxy)propoxy]propane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)(OCCCOC(CC(=O)O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20O14/c16-8(17)4-14(12(24)25,5-9(18)19)28-2-1-3-29-15(13(26)27,6-10(20)21)7-11(22)23/h1-7H2,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | DJGZPFHCCLNBHK-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|