C7H10O8 — CID 88843175
2-(hydroxymethoxy)propane-1,2,3-tricarboxylic acid (PubChem CID 88843175) has the molecular formula C7H10O8 and a molecular weight of 222.15 g/mol. Its IUPAC name is 2-(hydroxymethoxy)propane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(hydroxymethoxy)propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 88843175 |
| Molecular Formula | C7H10O8 |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2-(hydroxymethoxy)propane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)(OCO)C(=O)O |
| InChI | InChI=1S/C7H10O8/c8-3-15-7(6(13)14,1-4(9)10)2-5(11)12/h8H,1-3H2,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | GSRCZJDIBOITPK-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|