C18H34O10 — CID 87567102
2-butoxypropane-1,2,3-tricarboxylic acid;4-(4-hydroxybutoxy)butan-1-ol (PubChem CID 87567102) has the molecular formula C18H34O10 and a molecular weight of 410.46 g/mol. Its IUPAC name is 2-butoxypropane-1,2,3-tricarboxylic acid;4-(4-hydroxybutoxy)butan-1-ol.
| Compound Name | 2-butoxypropane-1,2,3-tricarboxylic acid;4-(4-hydroxybutoxy)butan-1-ol |
|---|---|
| PubChem CID | 87567102 |
| Molecular Formula | C18H34O10 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-butoxypropane-1,2,3-tricarboxylic acid;4-(4-hydroxybutoxy)butan-1-ol |
| SMILES | CCCCOC(CC(=O)O)(CC(=O)O)C(=O)O.OCCCCOCCCCO |
| InChI | InChI=1S/C10H16O7.C8H18O3/c1-2-3-4-17-10(9(15)16,5-7(11)12)6-8(13)14;9-5-1-3-7-11-8-4-2-6-10/h2-6H2,1H3,(H,11,12)(H,13,14)(H,15,16);9-10H,1-8H2 |
| InChIKey | UUXVHWPHKFBHSP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|