C14H24O7 — CID 141161538
2-[2-(2-methylbutan-2-yloxy)-2-oxoethyl]-2-propoxybutanedioic acid (PubChem CID 141161538) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-[2-(2-methylbutan-2-yloxy)-2-oxoethyl]-2-propoxybutanedioic acid.
| Compound Name | 2-[2-(2-methylbutan-2-yloxy)-2-oxoethyl]-2-propoxybutanedioic acid |
|---|---|
| PubChem CID | 141161538 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[2-(2-methylbutan-2-yloxy)-2-oxoethyl]-2-propoxybutanedioic acid |
| SMILES | CCCOC(CC(=O)O)(CC(=O)OC(C)(C)CC)C(=O)O |
| InChI | InChI=1S/C14H24O7/c1-5-7-20-14(12(18)19,8-10(15)16)9-11(17)21-13(3,4)6-2/h5-9H2,1-4H3,(H,15,16)(H,18,19) |
| InChIKey | GKQPOCTWYPWFKY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |