C16H19F9O9 — CID 175340096
2-[2-(2-ethoxyethoxy)ethoxy]-2-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethyl]butanedioic acid (PubChem CID 175340096) has the molecular formula C16H19F9O9 and a molecular weight of 526.30 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]-2-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]-2-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 175340096 |
| Molecular Formula | C16H19F9O9 |
| Molecular Weight | 526.30 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]-2-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethyl]butanedioic acid |
| SMILES | CCOCCOCCOC(CC(=O)O)(CC(=O)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H19F9O9/c1-2-31-3-4-32-5-6-33-12(11(29)30,7-9(26)27)8-10(28)34-13(14(17,18)19,15(20,21)22)16(23,24)25/h2-8H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | QCGAQUALLZRFGP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|