C15H28O7 — CID 67171689
benzene-1,4-diol;2,2-dimethylpropane-1,3-diol;2-(2-hydroxyethoxy)ethanol (PubChem CID 67171689) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is benzene-1,4-diol;2,2-dimethylpropane-1,3-diol;2-(2-hydroxyethoxy)ethanol.
| Compound Name | benzene-1,4-diol;2,2-dimethylpropane-1,3-diol;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 67171689 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | benzene-1,4-diol;2,2-dimethylpropane-1,3-diol;2-(2-hydroxyethoxy)ethanol |
| SMILES | CC(C)(CO)CO.OCCOCCO.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C5H12O2.C4H10O3/c7-5-1-2-6(8)4-3-5;1-5(2,3-6)4-7;5-1-3-7-4-2-6/h1-4,7-8H;6-7H,3-4H2,1-2H3;5-6H,1-4H2 |
| InChIKey | RSULVCPDWOSWSX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|