C26H38O8 — CID 67801336
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methylbut-2-enoic acid (PubChem CID 67801336) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methylbut-2-enoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 67801336 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-methylbut-2-enoic acid |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC=C(C)C(=O)O.OCCOCCOCCO |
| InChI | InChI=1S/C15H16O2.C6H14O4.C5H8O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;7-1-3-9-5-6-10-4-2-8;1-3-4(2)5(6)7/h3-10,16-17H,1-2H3;7-8H,1-6H2;3H,1-2H3,(H,6,7) |
| InChIKey | KNAUDWXHHZBJTB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|