C11H15ClN2O4 — CID 114899547
2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 114899547) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114899547 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(=O)C(C)(Cc1c(C)nn(C)c1Cl)C(=O)O |
| InChI | InChI=1S/C11H15ClN2O4/c1-6-7(8(12)14(3)13-6)5-11(2,9(15)16)10(17)18-4/h5H2,1-4H3,(H,15,16) |
| InChIKey | WPVATPKVYSXNPH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|