C15H16N2O3S — CID 114900324
2-(1,3-benzothiazol-2-ylmethyl)-3-(cyclopropylamino)-2-methyl-3-oxopropanoic acid (PubChem CID 114900324) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethyl)-3-(cyclopropylamino)-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethyl)-3-(cyclopropylamino)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114900324 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethyl)-3-(cyclopropylamino)-2-methyl-3-oxopropanoic acid |
| SMILES | CC(Cc1nc2ccccc2s1)(C(=O)O)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H16N2O3S/c1-15(14(19)20,13(18)16-9-6-7-9)8-12-17-10-4-2-3-5-11(10)21-12/h2-5,9H,6-8H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | CMAIKVQQZBSTKU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|