C10H14F3NO4 — CID 114900368
2-(cyclopropylcarbamoyl)-5,5,5-trifluoro-4-hydroxy-2-methylpentanoic acid (PubChem CID 114900368) has the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 2-(cyclopropylcarbamoyl)-5,5,5-trifluoro-4-hydroxy-2-methylpentanoic acid.
| Compound Name | 2-(cyclopropylcarbamoyl)-5,5,5-trifluoro-4-hydroxy-2-methylpentanoic acid |
|---|---|
| PubChem CID | 114900368 |
| Molecular Formula | C10H14F3NO4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-(cyclopropylcarbamoyl)-5,5,5-trifluoro-4-hydroxy-2-methylpentanoic acid |
| SMILES | CC(CC(O)C(F)(F)F)(C(=O)O)C(=O)NC1CC1 |
| InChI | InChI=1S/C10H14F3NO4/c1-9(8(17)18,4-6(15)10(11,12)13)7(16)14-5-2-3-5/h5-6,15H,2-4H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | BRCREWDBESQKJE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|