C16H21NO4 — CID 114900504
3-(cyclopropylamino)-2-[(2-methoxy-5-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid (PubChem CID 114900504) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-(cyclopropylamino)-2-[(2-methoxy-5-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-(cyclopropylamino)-2-[(2-methoxy-5-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114900504 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-(cyclopropylamino)-2-[(2-methoxy-5-methylphenyl)methyl]-2-methyl-3-oxopropanoic acid |
| SMILES | COc1ccc(C)cc1CC(C)(C(=O)O)C(=O)NC1CC1 |
| InChI | InChI=1S/C16H21NO4/c1-10-4-7-13(21-3)11(8-10)9-16(2,15(19)20)14(18)17-12-5-6-12/h4,7-8,12H,5-6,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | JMFKBYRCLRNHLU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|