About N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine
N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine (PubChem CID 114900525) has the molecular formula C11H14F4N2O2S
and a molecular weight of 314.30 g/mol. Its IUPAC name is N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine |
| PubChem CID | 114900525 |
| Molecular Formula | C11H14F4N2O2S |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine |
| SMILES | CCN(CCN)c1ccc(F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H14F4N2O2S/c1-2-17(6-5-16)9-4-3-8(12)7-10(9)20(18,19)11(13,14)15/h3-4,7H,2,5-6,16H2,1H3 |
| InChIKey | LUJZPAXHVSYSLT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
The IUPAC name of N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine (CID 114900525) is N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine.
What is the SMILES notation for N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
The canonical SMILES for N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine is CCN(CCN)c1ccc(F)cc1S(=O)(=O)C(F)(F)F.
What is the InChIKey of N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
The InChIKey is LUJZPAXHVSYSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F4N2O2S/c1-2-17(6-5-16)9-4-3-8(12)7-10(9)20(18,19)11(13,14)15/h3-4,7H,2,5-6,16H2,1H3.
What are the key properties of N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine has a molecular weight of 314.30 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]ethane-1,2-diamine is sourced from PubChem (CID 114900525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).