C10H14BrN3O2 — CID 114900661
N'-(2-bromo-4-nitrophenyl)-N'-ethylethane-1,2-diamine (PubChem CID 114900661) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is N'-(2-bromo-4-nitrophenyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N'-(2-bromo-4-nitrophenyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 114900661 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N'-(2-bromo-4-nitrophenyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)c1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C10H14BrN3O2/c1-2-13(6-5-12)10-4-3-8(14(15)16)7-9(10)11/h3-4,7H,2,5-6,12H2,1H3 |
| InChIKey | NWQWFIBMCVJVJQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|