C14H11BrCl2N2S — CID 114903509
4-bromo-2-(2,5-dichloro-4-methylanilino)benzenecarbothioamide (PubChem CID 114903509) has the molecular formula C14H11BrCl2N2S and a molecular weight of 390.13 g/mol. Its IUPAC name is 4-bromo-2-(2,5-dichloro-4-methylanilino)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(2,5-dichloro-4-methylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114903509 |
| Molecular Formula | C14H11BrCl2N2S |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 4-bromo-2-(2,5-dichloro-4-methylanilino)benzenecarbothioamide |
| SMILES | Cc1cc(Cl)c(Nc2cc(Br)ccc2C(N)=S)cc1Cl |
| InChI | InChI=1S/C14H11BrCl2N2S/c1-7-4-11(17)13(6-10(7)16)19-12-5-8(15)2-3-9(12)14(18)20/h2-6,19H,1H3,(H2,18,20) |
| InChIKey | LNLKPDDXYWZOHK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|