C16H17ClN2OS — CID 63513071
2-(4-chloro-2-methoxy-5-methylanilino)-4-methylbenzenecarbothioamide (PubChem CID 63513071) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxy-5-methylanilino)-4-methylbenzenecarbothioamide.
| Compound Name | 2-(4-chloro-2-methoxy-5-methylanilino)-4-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 63513071 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(4-chloro-2-methoxy-5-methylanilino)-4-methylbenzenecarbothioamide |
| SMILES | COc1cc(Cl)c(C)cc1Nc1cc(C)ccc1C(N)=S |
| InChI | InChI=1S/C16H17ClN2OS/c1-9-4-5-11(16(18)21)13(6-9)19-14-7-10(2)12(17)8-15(14)20-3/h4-8,19H,1-3H3,(H2,18,21) |
| InChIKey | OUUDVFDFXMDPTI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|