C13H13BrN2O2S — CID 114904301
4-bromo-N'-hydroxy-2-(2-thiophen-2-ylethoxy)benzenecarboximidamide (PubChem CID 114904301) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 4-bromo-N'-hydroxy-2-(2-thiophen-2-ylethoxy)benzenecarboximidamide.
| Compound Name | 4-bromo-N'-hydroxy-2-(2-thiophen-2-ylethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 114904301 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 4-bromo-N'-hydroxy-2-(2-thiophen-2-ylethoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Br)cc1OCCc1cccs1 |
| InChI | InChI=1S/C13H13BrN2O2S/c14-9-3-4-11(13(15)16-17)12(8-9)18-6-5-10-2-1-7-19-10/h1-4,7-8,17H,5-6H2,(H2,15,16) |
| InChIKey | TZIWZBDYNPBRTQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|