C10H10BrF3N2O2 — CID 114904356
4-bromo-N'-hydroxy-2-(3,3,3-trifluoropropoxy)benzenecarboximidamide (PubChem CID 114904356) has the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 4-bromo-N'-hydroxy-2-(3,3,3-trifluoropropoxy)benzenecarboximidamide.
| Compound Name | 4-bromo-N'-hydroxy-2-(3,3,3-trifluoropropoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 114904356 |
| Molecular Formula | C10H10BrF3N2O2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 4-bromo-N'-hydroxy-2-(3,3,3-trifluoropropoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Br)cc1OCCC(F)(F)F |
| InChI | InChI=1S/C10H10BrF3N2O2/c11-6-1-2-7(9(15)16-17)8(5-6)18-4-3-10(12,13)14/h1-2,5,17H,3-4H2,(H2,15,16) |
| InChIKey | WFBRZJQSARDOOK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|