C36H72O4Si2 — CID 11490535
tert-butyl-[(1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]oxolan-2-yl]oxolan-2-yl]undecoxy]-dimethylsilane (PubChem CID 11490535) has the molecular formula C36H72O4Si2 and a molecular weight of 625.14 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]oxolan-2-yl]oxolan-2-yl]undecoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]oxolan-2-yl]oxolan-2-yl]undecoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11490535 |
| Molecular Formula | C36H72O4Si2 |
| Molecular Weight | 625.14 g/mol |
| Exact Mass | 624.50 |
| IUPAC Name | tert-butyl-[(1R)-1-[(2S,5S)-5-[(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]oxolan-2-yl]oxolan-2-yl]undecoxy]-dimethylsilane |
| SMILES | C=CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@@H]([C@@H]2CC[C@@H]([C@@H](CCCCCCCCCC)O[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C36H72O4Si2/c1-13-15-17-18-19-20-21-22-24-34(40-42(11,12)36(6,7)8)32-28-26-30(38-32)29-25-27-31(37-29)33(23-16-14-2)39-41(9,10)35(3,4)5/h14,29-34H,2,13,15-28H2,1,3-12H3/t29-,30-,31+,32-,33+,34+/m0/s1 |
| InChIKey | OTMDISXWHOUUFR-BAKHARCTSA-N |
| XLogP | 11.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.14 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|