C16H14BrNO3 — CID 114907271
4-bromo-2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzoic acid (PubChem CID 114907271) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 4-bromo-2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzoic acid.
| Compound Name | 4-bromo-2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 114907271 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 4-bromo-2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(Br)cc1NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H14BrNO3/c17-11-5-6-13(16(19)20)14(8-11)18-9-12-7-10-3-1-2-4-15(10)21-12/h1-6,8,12,18H,7,9H2,(H,19,20) |
| InChIKey | BJKCEKHSOOIOGQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |