About 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline
4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline (PubChem CID 66348583) has the molecular formula C17H18BrNO
and a molecular weight of 332.24 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline |
| PubChem CID | 66348583 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C17H18BrNO/c1-11-7-14(18)8-12(2)17(11)19-10-15-9-13-5-3-4-6-16(13)20-15/h3-8,15,19H,9-10H2,1-2H3 |
| InChIKey | AUOUNXYIDVIKEB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline?
The IUPAC name of 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline (CID 66348583) is 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline?
The canonical SMILES for 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline is Cc1cc(Br)cc(C)c1NCC1Cc2ccccc2O1.
What is the InChIKey of 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline?
The InChIKey is AUOUNXYIDVIKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNO/c1-11-7-14(18)8-12(2)17(11)19-10-15-9-13-5-3-4-6-16(13)20-15/h3-8,15,19H,9-10H2,1-2H3.
What are the key properties of 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline?
4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline has a molecular weight of 332.24 g/mol, XLogP of 4.48, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2,6-dimethylaniline is sourced from PubChem (CID 66348583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).