C12H11BrN2O2S — CID 114907279
4-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]benzoic acid (PubChem CID 114907279) has the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. Its IUPAC name is 4-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]benzoic acid.
| Compound Name | 4-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 114907279 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]benzoic acid |
| SMILES | Cc1csc(CNc2cc(Br)ccc2C(=O)O)n1 |
| InChI | InChI=1S/C12H11BrN2O2S/c1-7-6-18-11(15-7)5-14-10-4-8(13)2-3-9(10)12(16)17/h2-4,6,14H,5H2,1H3,(H,16,17) |
| InChIKey | LGHVFHHYBYVHBM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |