C13H12BrN3O2 — CID 114907355
4-bromo-2-[(5-methylpyrazin-2-yl)methylamino]benzoic acid (PubChem CID 114907355) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is 4-bromo-2-[(5-methylpyrazin-2-yl)methylamino]benzoic acid.
| Compound Name | 4-bromo-2-[(5-methylpyrazin-2-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 114907355 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 4-bromo-2-[(5-methylpyrazin-2-yl)methylamino]benzoic acid |
| SMILES | Cc1cnc(CNc2cc(Br)ccc2C(=O)O)cn1 |
| InChI | InChI=1S/C13H12BrN3O2/c1-8-5-16-10(6-15-8)7-17-12-4-9(14)2-3-11(12)13(18)19/h2-6,17H,7H2,1H3,(H,18,19) |
| InChIKey | GJUBDXOGKNSQGM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |