C11H7F3N6 — CID 114909132
8-[5-(trifluoromethyl)-2-pyridinyl]-7H-purin-6-amine (PubChem CID 114909132) has the molecular formula C11H7F3N6 and a molecular weight of 280.21 g/mol. Its IUPAC name is 8-[5-(trifluoromethyl)-2-pyridinyl]-7H-purin-6-amine.
| Compound Name | 8-[5-(trifluoromethyl)-2-pyridinyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 114909132 |
| Molecular Formula | C11H7F3N6 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 8-[5-(trifluoromethyl)-2-pyridinyl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(-c3ccc(C(F)(F)F)cn3)[nH]c12 |
| InChI | InChI=1S/C11H7F3N6/c12-11(13,14)5-1-2-6(16-3-5)9-19-7-8(15)17-4-18-10(7)20-9/h1-4H,(H3,15,17,18,19,20) |
| InChIKey | HGPUWCHEAFIOGE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |