C13H13NO3S2 — CID 114911166
5-(1-benzothiophen-2-yl)-1-oxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 114911166) has the molecular formula C13H13NO3S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)-1-oxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 5-(1-benzothiophen-2-yl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 114911166 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)-1-oxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)CC(c2cc3ccccc3s2)N1 |
| InChI | InChI=1S/C13H13NO3S2/c15-13(16)10-7-19(17)6-9(14-10)12-5-8-3-1-2-4-11(8)18-12/h1-5,9-10,14H,6-7H2,(H,15,16) |
| InChIKey | OPVOPGPICBYRHZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |