About 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid
5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 114911167) has the molecular formula C13H13NO4S2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
| PubChem CID | 114911167 |
| Molecular Formula | C13H13NO4S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)(=O)CC(c2cc3ccccc3s2)N1 |
| InChI | InChI=1S/C13H13NO4S2/c15-13(16)10-7-20(17,18)6-9(14-10)12-5-8-3-1-2-4-11(8)19-12/h1-5,9-10,14H,6-7H2,(H,15,16) |
| InChIKey | JLNLNRUHSVAXFQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid?
The IUPAC name of 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid (CID 114911167) is 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid.
What is the SMILES notation for 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid?
The canonical SMILES for 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid is O=C(O)C1CS(=O)(=O)CC(c2cc3ccccc3s2)N1.
What is the InChIKey of 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid?
The InChIKey is JLNLNRUHSVAXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S2/c15-13(16)10-7-20(17,18)6-9(14-10)12-5-8-3-1-2-4-11(8)19-12/h1-5,9-10,14H,6-7H2,(H,15,16).
What are the key properties of 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid?
5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid has a molecular weight of 311.38 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-benzothiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid is sourced from PubChem (CID 114911167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).