C12H12N2O4S — CID 65170874
5-(4-cyanophenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 65170874) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 5-(4-cyanophenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 5-(4-cyanophenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 65170874 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-(4-cyanophenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | N#Cc1ccc(C2CS(=O)(=O)CC(C(=O)O)N2)cc1 |
| InChI | InChI=1S/C12H12N2O4S/c13-5-8-1-3-9(4-2-8)10-6-19(17,18)7-11(14-10)12(15)16/h1-4,10-11,14H,6-7H2,(H,15,16) |
| InChIKey | UHGAUZDYJIAYHP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |