C8H13N5OS — CID 114912326
2-piperazin-1-yl-N-(thiadiazol-5-yl)acetamide (PubChem CID 114912326) has the molecular formula C8H13N5OS and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-(thiadiazol-5-yl)acetamide.
| Compound Name | 2-piperazin-1-yl-N-(thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 114912326 |
| Molecular Formula | C8H13N5OS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-piperazin-1-yl-N-(thiadiazol-5-yl)acetamide |
| SMILES | O=C(CN1CCNCC1)Nc1cnns1 |
| InChI | InChI=1S/C8H13N5OS/c14-7(11-8-5-10-12-15-8)6-13-3-1-9-2-4-13/h5,9H,1-4,6H2,(H,11,14) |
| InChIKey | VWFLCUZBNSPYNG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |