C7H13N5O2S2 — CID 114912971
1-piperidin-3-yl-N-(thiatriazol-5-yl)methanesulfonamide (PubChem CID 114912971) has the molecular formula C7H13N5O2S2 and a molecular weight of 263.35 g/mol. Its IUPAC name is 1-piperidin-3-yl-N-(thiatriazol-5-yl)methanesulfonamide.
| Compound Name | 1-piperidin-3-yl-N-(thiatriazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 114912971 |
| Molecular Formula | C7H13N5O2S2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-piperidin-3-yl-N-(thiatriazol-5-yl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCNC1)Nc1nnns1 |
| InChI | InChI=1S/C7H13N5O2S2/c13-16(14,10-7-9-11-12-15-7)5-6-2-1-3-8-4-6/h6,8H,1-5H2,(H,9,10,12) |
| InChIKey | MYIYHTYLMVLDMS-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |