C12H16N6OS — CID 114913975
1-[3-[1-(ethylamino)ethyl]phenyl]-3-(thiatriazol-5-yl)urea (PubChem CID 114913975) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-[3-[1-(ethylamino)ethyl]phenyl]-3-(thiatriazol-5-yl)urea.
| Compound Name | 1-[3-[1-(ethylamino)ethyl]phenyl]-3-(thiatriazol-5-yl)urea |
|---|---|
| PubChem CID | 114913975 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-[3-[1-(ethylamino)ethyl]phenyl]-3-(thiatriazol-5-yl)urea |
| SMILES | CCNC(C)c1cccc(NC(=O)Nc2nnns2)c1 |
| InChI | InChI=1S/C12H16N6OS/c1-3-13-8(2)9-5-4-6-10(7-9)14-11(19)15-12-16-17-18-20-12/h4-8,13H,3H2,1-2H3,(H2,14,15,16,18,19) |
| InChIKey | VCLJJJWVPXYEJO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |