C12H13FN4OS — CID 114914162
3-fluoro-2-(propylamino)-N-(thiadiazol-5-yl)benzamide (PubChem CID 114914162) has the molecular formula C12H13FN4OS and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-fluoro-2-(propylamino)-N-(thiadiazol-5-yl)benzamide.
| Compound Name | 3-fluoro-2-(propylamino)-N-(thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 114914162 |
| Molecular Formula | C12H13FN4OS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-fluoro-2-(propylamino)-N-(thiadiazol-5-yl)benzamide |
| SMILES | CCCNc1c(F)cccc1C(=O)Nc1cnns1 |
| InChI | InChI=1S/C12H13FN4OS/c1-2-6-14-11-8(4-3-5-9(11)13)12(18)16-10-7-15-17-19-10/h3-5,7,14H,2,6H2,1H3,(H,16,18) |
| InChIKey | YXAHIZSZXTUUQT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |