C15H24FN3O — CID 62660881
N-[2-(dimethylamino)propyl]-3-fluoro-2-(propylamino)benzamide (PubChem CID 62660881) has the molecular formula C15H24FN3O and a molecular weight of 281.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)propyl]-3-fluoro-2-(propylamino)benzamide.
| Compound Name | N-[2-(dimethylamino)propyl]-3-fluoro-2-(propylamino)benzamide |
|---|---|
| PubChem CID | 62660881 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-[2-(dimethylamino)propyl]-3-fluoro-2-(propylamino)benzamide |
| SMILES | CCCNc1c(F)cccc1C(=O)NCC(C)N(C)C |
| InChI | InChI=1S/C15H24FN3O/c1-5-9-17-14-12(7-6-8-13(14)16)15(20)18-10-11(2)19(3)4/h6-8,11,17H,5,9-10H2,1-4H3,(H,18,20) |
| InChIKey | WNZCEIYAKWJLNQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |