C13H20FN3O3S — CID 62662394
3-fluoro-N-[2-(methanesulfonamido)ethyl]-2-(propylamino)benzamide (PubChem CID 62662394) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-fluoro-N-[2-(methanesulfonamido)ethyl]-2-(propylamino)benzamide.
| Compound Name | 3-fluoro-N-[2-(methanesulfonamido)ethyl]-2-(propylamino)benzamide |
|---|---|
| PubChem CID | 62662394 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-fluoro-N-[2-(methanesulfonamido)ethyl]-2-(propylamino)benzamide |
| SMILES | CCCNc1c(F)cccc1C(=O)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C13H20FN3O3S/c1-3-7-15-12-10(5-4-6-11(12)14)13(18)16-8-9-17-21(2,19)20/h4-6,15,17H,3,7-9H2,1-2H3,(H,16,18) |
| InChIKey | KEQKEKCQRUFASF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|