C9H10N6OS — CID 114914340
6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide (PubChem CID 114914340) has the molecular formula C9H10N6OS and a molecular weight of 250.29 g/mol. Its IUPAC name is 6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114914340 |
| Molecular Formula | C9H10N6OS |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide |
| SMILES | CCNc1cccc(C(=O)Nc2nnns2)n1 |
| InChI | InChI=1S/C9H10N6OS/c1-2-10-7-5-3-4-6(11-7)8(16)12-9-13-14-15-17-9/h3-5H,2H2,1H3,(H,10,11)(H,12,13,15,16) |
| InChIKey | LROOGNMSAKJYSE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |