C10H11ClN6OS — CID 114914367
3-chloro-6-(propylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide (PubChem CID 114914367) has the molecular formula C10H11ClN6OS and a molecular weight of 298.76 g/mol. Its IUPAC name is 3-chloro-6-(propylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(propylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114914367 |
| Molecular Formula | C10H11ClN6OS |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-chloro-6-(propylamino)-N-(thiatriazol-5-yl)pyridine-2-carboxamide |
| SMILES | CCCNc1ccc(Cl)c(C(=O)Nc2nnns2)n1 |
| InChI | InChI=1S/C10H11ClN6OS/c1-2-5-12-7-4-3-6(11)8(13-7)9(18)14-10-15-16-17-19-10/h3-4H,2,5H2,1H3,(H,12,13)(H,14,15,17,18) |
| InChIKey | CSUBSYPMWVFBJO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |