C14H22ClN3O — CID 62691457
3-chloro-N-(2-methylbutyl)-6-(propylamino)pyridine-2-carboxamide (PubChem CID 62691457) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 3-chloro-N-(2-methylbutyl)-6-(propylamino)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-(2-methylbutyl)-6-(propylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62691457 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-chloro-N-(2-methylbutyl)-6-(propylamino)pyridine-2-carboxamide |
| SMILES | CCCNc1ccc(Cl)c(C(=O)NCC(C)CC)n1 |
| InChI | InChI=1S/C14H22ClN3O/c1-4-8-16-12-7-6-11(15)13(18-12)14(19)17-9-10(3)5-2/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | KQSHRYROOCURAN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |