C11H14N2O4S2 — CID 114914797
3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-4-methylthiophene-2-carboxylic acid (PubChem CID 114914797) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114914797 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1NC(=O)CCSCC(N)=O |
| InChI | InChI=1S/C11H14N2O4S2/c1-6-4-19-10(11(16)17)9(6)13-8(15)2-3-18-5-7(12)14/h4H,2-3,5H2,1H3,(H2,12,14)(H,13,15)(H,16,17) |
| InChIKey | VWXNYKJMVVEQJZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|