C12H12N2O3S — CID 114915703
methyl 3-[(1-cyanocyclopropanecarbonyl)amino]-4-methylthiophene-2-carboxylate (PubChem CID 114915703) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is methyl 3-[(1-cyanocyclopropanecarbonyl)amino]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(1-cyanocyclopropanecarbonyl)amino]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114915703 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | methyl 3-[(1-cyanocyclopropanecarbonyl)amino]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)C1(C#N)CC1 |
| InChI | InChI=1S/C12H12N2O3S/c1-7-5-18-9(10(15)17-2)8(7)14-11(16)12(6-13)3-4-12/h5H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | SXZNMXFCBCAITF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |