C15H20Cl2N2O — CID 114918549
2,5-dichloro-N-[2-(3-methylcyclohexyl)ethyl]pyridine-4-carboxamide (PubChem CID 114918549) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(3-methylcyclohexyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-(3-methylcyclohexyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918549 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2,5-dichloro-N-[2-(3-methylcyclohexyl)ethyl]pyridine-4-carboxamide |
| SMILES | CC1CCCC(CCNC(=O)c2cc(Cl)ncc2Cl)C1 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10-3-2-4-11(7-10)5-6-18-15(20)12-8-14(17)19-9-13(12)16/h8-11H,2-7H2,1H3,(H,18,20) |
| InChIKey | WOJYWYFIABYXKW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|