C11H13ClN2O3 — CID 114919257
5-chloro-2-(oxan-4-ylamino)pyridine-4-carboxylic acid (PubChem CID 114919257) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is 5-chloro-2-(oxan-4-ylamino)pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-(oxan-4-ylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919257 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-chloro-2-(oxan-4-ylamino)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(NC2CCOCC2)ncc1Cl |
| InChI | InChI=1S/C11H13ClN2O3/c12-9-6-13-10(5-8(9)11(15)16)14-7-1-3-17-4-2-7/h5-7H,1-4H2,(H,13,14)(H,15,16) |
| InChIKey | CZAOZRVOMDCBKV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |