C12H15ClN2O2 — CID 114919638
5-chloro-2-[(2-methylcyclopentyl)amino]pyridine-4-carboxylic acid (PubChem CID 114919638) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-chloro-2-[(2-methylcyclopentyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[(2-methylcyclopentyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919638 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-chloro-2-[(2-methylcyclopentyl)amino]pyridine-4-carboxylic acid |
| SMILES | CC1CCCC1Nc1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C12H15ClN2O2/c1-7-3-2-4-10(7)15-11-5-8(12(16)17)9(13)6-14-11/h5-7,10H,2-4H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | GUOIVHLESVKMFN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |