C16H18ClN3O — CID 114922855
5-chloro-N-(4-ethylphenyl)-N-methyl-2-(methylamino)pyridine-4-carboxamide (PubChem CID 114922855) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 5-chloro-N-(4-ethylphenyl)-N-methyl-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(4-ethylphenyl)-N-methyl-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114922855 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-chloro-N-(4-ethylphenyl)-N-methyl-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CCc1ccc(N(C)C(=O)c2cc(NC)ncc2Cl)cc1 |
| InChI | InChI=1S/C16H18ClN3O/c1-4-11-5-7-12(8-6-11)20(3)16(21)13-9-15(18-2)19-10-14(13)17/h5-10H,4H2,1-3H3,(H,18,19) |
| InChIKey | WQMRCPJMNMCCAH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |