C15H22ClN3OS — CID 114924716
[5-chloro-2-(propylamino)-4-pyridinyl]-(2-ethylthiomorpholin-4-yl)methanone (PubChem CID 114924716) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is [5-chloro-2-(propylamino)-4-pyridinyl]-(2-ethylthiomorpholin-4-yl)methanone.
| Compound Name | [5-chloro-2-(propylamino)-4-pyridinyl]-(2-ethylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 114924716 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [5-chloro-2-(propylamino)-4-pyridinyl]-(2-ethylthiomorpholin-4-yl)methanone |
| SMILES | CCCNc1cc(C(=O)N2CCSC(CC)C2)c(Cl)cn1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-3-5-17-14-8-12(13(16)9-18-14)15(20)19-6-7-21-11(4-2)10-19/h8-9,11H,3-7,10H2,1-2H3,(H,17,18) |
| InChIKey | GTNSIPOANBBUHJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |