C14H21ClN4 — CID 114926380
[2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-chloro-4-pyridinyl]methanamine (PubChem CID 114926380) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is [2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-chloro-4-pyridinyl]methanamine.
| Compound Name | [2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-chloro-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114926380 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-chloro-4-pyridinyl]methanamine |
| SMILES | NCc1cc(N2CCCN3CCCC3C2)ncc1Cl |
| InChI | InChI=1S/C14H21ClN4/c15-13-9-17-14(7-11(13)8-16)19-6-2-5-18-4-1-3-12(18)10-19/h7,9,12H,1-6,8,10,16H2 |
| InChIKey | CAVRZPCBQNTZTP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |