C12H19N5 — CID 79940812
[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]methanamine (PubChem CID 79940812) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is [5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]methanamine.
| Compound Name | [5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 79940812 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | [5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]methanamine |
| SMILES | NCc1cnc(N2CCN3CCCC3C2)cn1 |
| InChI | InChI=1S/C12H19N5/c13-6-10-7-15-12(8-14-10)17-5-4-16-3-1-2-11(16)9-17/h7-8,11H,1-6,9,13H2 |
| InChIKey | MSRWFXSPZQVSQA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |