C13H20ClN3 — CID 114926894
5-chloro-N-ethyl-4-(ethylaminomethyl)-N-prop-2-enylpyridin-2-amine (PubChem CID 114926894) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is 5-chloro-N-ethyl-4-(ethylaminomethyl)-N-prop-2-enylpyridin-2-amine.
| Compound Name | 5-chloro-N-ethyl-4-(ethylaminomethyl)-N-prop-2-enylpyridin-2-amine |
|---|---|
| PubChem CID | 114926894 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-chloro-N-ethyl-4-(ethylaminomethyl)-N-prop-2-enylpyridin-2-amine |
| SMILES | C=CCN(CC)c1cc(CNCC)c(Cl)cn1 |
| InChI | InChI=1S/C13H20ClN3/c1-4-7-17(6-3)13-8-11(9-15-5-2)12(14)10-16-13/h4,8,10,15H,1,5-7,9H2,2-3H3 |
| InChIKey | KLZNWVFWEBMIAF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|