C10H15ClN2O — CID 114920176
[5-chloro-2-(diethylamino)-4-pyridinyl]methanol (PubChem CID 114920176) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is [5-chloro-2-(diethylamino)-4-pyridinyl]methanol.
| Compound Name | [5-chloro-2-(diethylamino)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 114920176 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | [5-chloro-2-(diethylamino)-4-pyridinyl]methanol |
| SMILES | CCN(CC)c1cc(CO)c(Cl)cn1 |
| InChI | InChI=1S/C10H15ClN2O/c1-3-13(4-2)10-5-8(7-14)9(11)6-12-10/h5-6,14H,3-4,7H2,1-2H3 |
| InChIKey | VMZRADPGXFKAKF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |